C12H21N4O6PS2 — CID 173425059
methane;5-methyl-2-[(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one;phosphoric acid (PubChem CID 173425059) has the molecular formula C12H21N4O6PS2 and a molecular weight of 412.43 g/mol. Its IUPAC name is methane;5-methyl-2-[(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one;phosphoric acid.
| Compound Name | methane;5-methyl-2-[(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one;phosphoric acid |
|---|---|
| PubChem CID | 173425059 |
| Molecular Formula | C12H21N4O6PS2 |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | methane;5-methyl-2-[(3-methyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one;phosphoric acid |
| SMILES | C.C=CCN1C(=O)C(C)SC1=NN=C1SCC(=O)N1C.O=P(O)(O)O |
| InChI | InChI=1S/C11H14N4O2S2.CH4.H3O4P/c1-4-5-15-9(17)7(2)19-11(15)13-12-10-14(3)8(16)6-18-10;;1-5(2,3)4/h4,7H,1,5-6H2,2-3H3;1H4;(H3,1,2,3,4) |
| InChIKey | GRYVHFPGKJEACD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 143.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|