C14H21N4O6PS2 — CID 54256974
dimethyl [3-methyl-2-[[5-methyl-3-(2-methylprop-2-enyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl] phosphate (PubChem CID 54256974) has the molecular formula C14H21N4O6PS2 and a molecular weight of 436.45 g/mol. Its IUPAC name is dimethyl [3-methyl-2-[[5-methyl-3-(2-methylprop-2-enyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl] phosphate.
| Compound Name | dimethyl [3-methyl-2-[[5-methyl-3-(2-methylprop-2-enyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl] phosphate |
|---|---|
| PubChem CID | 54256974 |
| Molecular Formula | C14H21N4O6PS2 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | dimethyl [3-methyl-2-[[5-methyl-3-(2-methylprop-2-enyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl] phosphate |
| SMILES | C=C(C)CN1C(=O)C(C)SC1=NN=C1SC(OP(=O)(OC)OC)C(=O)N1C |
| InChI | InChI=1S/C14H21N4O6PS2/c1-8(2)7-18-10(19)9(3)26-14(18)16-15-13-17(4)11(20)12(27-13)24-25(21,22-5)23-6/h9,12H,1,7H2,2-6H3 |
| InChIKey | RATJGWYKGOENRJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 110.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|