C13H19N4O6PS2 — CID 6913120
methyl [(2E)-3-methyl-2-[(E)-[5-methyl-3-(2-methylprop-2-enyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl] hydrogen phosphate (PubChem CID 6913120) has the molecular formula C13H19N4O6PS2 and a molecular weight of 422.43 g/mol. Its IUPAC name is methyl [(2E)-3-methyl-2-[(E)-[5-methyl-3-(2-methylprop-2-enyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl] hydrogen phosphate.
| Compound Name | methyl [(2E)-3-methyl-2-[(E)-[5-methyl-3-(2-methylprop-2-enyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 6913120 |
| Molecular Formula | C13H19N4O6PS2 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | methyl [(2E)-3-methyl-2-[(E)-[5-methyl-3-(2-methylprop-2-enyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl] hydrogen phosphate |
| SMILES | C=C(C)CN1C(=O)C(C)S/C1=N/N=C1/SC(OP(=O)(O)OC)C(=O)N1C |
| InChI | InChI=1S/C13H19N4O6PS2/c1-7(2)6-17-9(18)8(3)25-13(17)15-14-12-16(4)10(19)11(26-12)23-24(20,21)22-5/h8,11H,1,6H2,2-5H3,(H,20,21)/b14-12+,15-13+ |
| InChIKey | ODWWLZZJQZIJGP-QUMQEAAQSA-N |
| XLogP | 1.45 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|