C10H12N4OS2 — CID 54168787
1-[(4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene)amino]-3-prop-1-ynylthiourea (PubChem CID 54168787) has the molecular formula C10H12N4OS2 and a molecular weight of 268.37 g/mol. Its IUPAC name is 1-[(4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene)amino]-3-prop-1-ynylthiourea.
| Compound Name | 1-[(4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene)amino]-3-prop-1-ynylthiourea |
|---|---|
| PubChem CID | 54168787 |
| Molecular Formula | C10H12N4OS2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-[(4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene)amino]-3-prop-1-ynylthiourea |
| SMILES | C=CCN1C(=O)CSC1=NNC(=S)NC#CC |
| InChI | InChI=1S/C10H12N4OS2/c1-3-5-11-9(16)12-13-10-14(6-4-2)8(15)7-17-10/h4H,2,6-7H2,1H3,(H2,11,12,16) |
| InChIKey | OTOBZBCASSOIAF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|