C25H23N3O3S — CID 14984002
2-hydroxy-N-[(Z)-[4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-ylidene]amino]-2,2-diphenylacetamide (PubChem CID 14984002) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-hydroxy-N-[(Z)-[4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-ylidene]amino]-2,2-diphenylacetamide.
| Compound Name | 2-hydroxy-N-[(Z)-[4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-ylidene]amino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 14984002 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-hydroxy-N-[(Z)-[4-oxo-3-(2-phenylethyl)-1,3-thiazolidin-2-ylidene]amino]-2,2-diphenylacetamide |
| SMILES | O=C1CS/C(=N\NC(=O)C(O)(c2ccccc2)c2ccccc2)N1CCc1ccccc1 |
| InChI | InChI=1S/C25H23N3O3S/c29-22-18-32-24(28(22)17-16-19-10-4-1-5-11-19)27-26-23(30)25(31,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,31H,16-18H2,(H,26,30)/b27-24- |
| InChIKey | RBDXXUNWVMWGPS-PNHLSOANSA-N |
| XLogP | 3.13 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|