C15H16N4O3S2 — CID 139643243
benzyl N-[[(Z)-(4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene)amino]carbamothioyl]carbamate (PubChem CID 139643243) has the molecular formula C15H16N4O3S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is benzyl N-[[(Z)-(4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene)amino]carbamothioyl]carbamate.
| Compound Name | benzyl N-[[(Z)-(4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene)amino]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 139643243 |
| Molecular Formula | C15H16N4O3S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | benzyl N-[[(Z)-(4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene)amino]carbamothioyl]carbamate |
| SMILES | C=CCN1C(=O)CS/C1=N\NC(=S)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H16N4O3S2/c1-2-8-19-12(20)10-24-14(19)18-17-13(23)16-15(21)22-9-11-6-4-3-5-7-11/h2-7H,1,8-10H2,(H2,16,17,21,23)/b18-14- |
| InChIKey | QFLHKMSPUXOTQS-JXAWBTAJSA-N |
| XLogP | 1.82 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|