C16H17N2OS2+ — CID 1115414
(2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 1115414) has the molecular formula C16H17N2OS2+ and a molecular weight of 317.46 g/mol. Its IUPAC name is (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1115414 |
| Molecular Formula | C16H17N2OS2+ |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (2Z)-2-[(3-ethyl-1,3-benzothiazol-3-ium-2-yl)methylidene]-3-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)CS/C1=C\c1sc2ccccc2[n+]1CC |
| InChI | InChI=1S/C16H17N2OS2/c1-3-9-18-14(19)11-20-15(18)10-16-17(4-2)12-7-5-6-8-13(12)21-16/h3,5-8,10H,1,4,9,11H2,2H3/q+1 |
| InChIKey | KTEAAWYKHAYNMV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|