C6H5NO2S2 — CID 142577094
2-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetaldehyde (PubChem CID 142577094) has the molecular formula C6H5NO2S2 and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetaldehyde.
| Compound Name | 2-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetaldehyde |
|---|---|
| PubChem CID | 142577094 |
| Molecular Formula | C6H5NO2S2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 186.98 |
| IUPAC Name | 2-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetaldehyde |
| SMILES | C=C1SC(=S)N(CC=O)C1=O |
| InChI | InChI=1S/C6H5NO2S2/c1-4-5(9)7(2-3-8)6(10)11-4/h3H,1-2H2 |
| InChIKey | RRTAYLRKLDJNPG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|