C19H26N2O2S2 — CID 143386380
4-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-(7-tricyclo[5.3.1.03,9]undecanyl)butanamide (PubChem CID 143386380) has the molecular formula C19H26N2O2S2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 4-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-(7-tricyclo[5.3.1.03,9]undecanyl)butanamide.
| Compound Name | 4-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-(7-tricyclo[5.3.1.03,9]undecanyl)butanamide |
|---|---|
| PubChem CID | 143386380 |
| Molecular Formula | C19H26N2O2S2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 4-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-(7-tricyclo[5.3.1.03,9]undecanyl)butanamide |
| SMILES | C=C1SC(=S)N(CCCC(=O)NC23CCCC4CC(CC4C2)C3)C1=O |
| InChI | InChI=1S/C19H26N2O2S2/c1-12-17(23)21(18(24)25-12)7-3-5-16(22)20-19-6-2-4-14-8-13(10-19)9-15(14)11-19/h13-15H,1-11H2,(H,20,22) |
| InChIKey | WSVMNRLJYKKDFJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|