C6H7NOS2 — CID 23558212
3-ethyl-4-methylidene-2-sulfanylidene-1,3-thiazolidin-5-one (PubChem CID 23558212) has the molecular formula C6H7NOS2 and a molecular weight of 173.26 g/mol. Its IUPAC name is 3-ethyl-4-methylidene-2-sulfanylidene-1,3-thiazolidin-5-one.
| Compound Name | 3-ethyl-4-methylidene-2-sulfanylidene-1,3-thiazolidin-5-one |
|---|---|
| PubChem CID | 23558212 |
| Molecular Formula | C6H7NOS2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.00 |
| IUPAC Name | 3-ethyl-4-methylidene-2-sulfanylidene-1,3-thiazolidin-5-one |
| SMILES | C=C1C(=O)SC(=S)N1CC |
| InChI | InChI=1S/C6H7NOS2/c1-3-7-4(2)5(8)10-6(7)9/h2-3H2,1H3 |
| InChIKey | UGEPHHOUVFMXRN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|