C12H22N2O3S — CID 142205447
1,3-diethyl-5-methylidene-2-sulfanylidene-1,3-diazinane-4,6-dione;propane;hydrate (PubChem CID 142205447) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is 1,3-diethyl-5-methylidene-2-sulfanylidene-1,3-diazinane-4,6-dione;propane;hydrate.
| Compound Name | 1,3-diethyl-5-methylidene-2-sulfanylidene-1,3-diazinane-4,6-dione;propane;hydrate |
|---|---|
| PubChem CID | 142205447 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1,3-diethyl-5-methylidene-2-sulfanylidene-1,3-diazinane-4,6-dione;propane;hydrate |
| SMILES | C=C1C(=O)N(CC)C(=S)N(CC)C1=O.CCC.O |
| InChI | InChI=1S/C9H12N2O2S.C3H8.H2O/c1-4-10-7(12)6(3)8(13)11(5-2)9(10)14;1-3-2;/h3-5H2,1-2H3;3H2,1-2H3;1H2 |
| InChIKey | MPUMUCMSXAJBTI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|