C15H13BrN2O5S2 — CID 18527897
1-bromo-2-nitro-4-[(E)-prop-1-enyl]benzene;2-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetic acid (PubChem CID 18527897) has the molecular formula C15H13BrN2O5S2 and a molecular weight of 445.32 g/mol. Its IUPAC name is 1-bromo-2-nitro-4-[(E)-prop-1-enyl]benzene;2-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetic acid.
| Compound Name | 1-bromo-2-nitro-4-[(E)-prop-1-enyl]benzene;2-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetic acid |
|---|---|
| PubChem CID | 18527897 |
| Molecular Formula | C15H13BrN2O5S2 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 443.94 |
| IUPAC Name | 1-bromo-2-nitro-4-[(E)-prop-1-enyl]benzene;2-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetic acid |
| SMILES | C/C=C/c1ccc(Br)c([N+](=O)[O-])c1.C=C1SC(=S)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C9H8BrNO2.C6H5NO3S2/c1-2-3-7-4-5-8(10)9(6-7)11(12)13;1-3-5(10)7(2-4(8)9)6(11)12-3/h2-6H,1H3;1-2H2,(H,8,9)/b3-2+; |
| InChIKey | KRAUMGDEKRSHKB-SQQVDAMQSA-N |
| XLogP | 3.84 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|