C6H4NNaO3S2 — CID 58798324
sodium 2-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetate (PubChem CID 58798324) has the molecular formula C6H4NNaO3S2 and a molecular weight of 225.23 g/mol. Its IUPAC name is sodium 2-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetate.
| Compound Name | sodium 2-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetate |
|---|---|
| PubChem CID | 58798324 |
| Molecular Formula | C6H4NNaO3S2 |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 224.95 |
| IUPAC Name | sodium 2-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetate |
| SMILES | C=C1SC(=S)N(CC(=O)[O-])C1=O.[Na+] |
| InChI | InChI=1S/C6H5NO3S2.Na/c1-3-5(10)7(2-4(8)9)6(11)12-3;/h1-2H2,(H,8,9);/q;+1/p-1 |
| InChIKey | BAQVFCGTEJPKTD-UHFFFAOYSA-M |
| XLogP | -3.89 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|