C13H5N5OS4 — CID 153332708
2-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile (PubChem CID 153332708) has the molecular formula C13H5N5OS4 and a molecular weight of 375.49 g/mol. Its IUPAC name is 2-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile.
| Compound Name | 2-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 153332708 |
| Molecular Formula | C13H5N5OS4 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 374.94 |
| IUPAC Name | 2-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)-[1,3]dithiolo[4,5-b]pyrazine-5,6-dicarbonitrile |
| SMILES | C=CCN1C(=O)C(=C2Sc3nc(C#N)c(C#N)nc3S2)SC1=S |
| InChI | InChI=1S/C13H5N5OS4/c1-2-3-18-11(19)8(21-13(18)20)12-22-9-10(23-12)17-7(5-15)6(4-14)16-9/h2H,1,3H2 |
| InChIKey | MEULURIBHYXMDD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 93.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|