C11H7N3O2S3 — CID 153332706
5-([1,3]dithiolo[4,5-b]pyrazin-2-ylidene)-3-prop-2-enyl-1,3-thiazolidine-2,4-dione (PubChem CID 153332706) has the molecular formula C11H7N3O2S3 and a molecular weight of 309.40 g/mol. Its IUPAC name is 5-([1,3]dithiolo[4,5-b]pyrazin-2-ylidene)-3-prop-2-enyl-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-([1,3]dithiolo[4,5-b]pyrazin-2-ylidene)-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 153332706 |
| Molecular Formula | C11H7N3O2S3 |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | 5-([1,3]dithiolo[4,5-b]pyrazin-2-ylidene)-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)SC(=C2Sc3nccnc3S2)C1=O |
| InChI | InChI=1S/C11H7N3O2S3/c1-2-5-14-9(15)6(17-11(14)16)10-18-7-8(19-10)13-4-3-12-7/h2-4H,1,5H2 |
| InChIKey | UZHWXRIFOGDTJL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|