C12H16N2OS3 — CID 124512254
(5E)-5-[(4R)-3-ethyl-4-methyl-1,3-thiazolidin-2-ylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 124512254) has the molecular formula C12H16N2OS3 and a molecular weight of 300.47 g/mol. Its IUPAC name is (5E)-5-[(4R)-3-ethyl-4-methyl-1,3-thiazolidin-2-ylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(4R)-3-ethyl-4-methyl-1,3-thiazolidin-2-ylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 124512254 |
| Molecular Formula | C12H16N2OS3 |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | (5E)-5-[(4R)-3-ethyl-4-methyl-1,3-thiazolidin-2-ylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C2\SC[C@@H](C)N2CC)SC1=S |
| InChI | InChI=1S/C12H16N2OS3/c1-4-6-14-10(15)9(18-12(14)16)11-13(5-2)8(3)7-17-11/h4,8H,1,5-7H2,2-3H3/b11-9+/t8-/m1/s1 |
| InChIKey | BSMWDQLLFDTJEQ-ITCPUHJZSA-N |
| XLogP | 2.66 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|