C15H20N3O5+ — CID 87342161
1,3-bis(oxiran-2-ylmethyl)-1,5-bis(prop-2-enyl)-1,3,5-triazinan-1-ium-2,4,6-trione (PubChem CID 87342161) has the molecular formula C15H20N3O5+ and a molecular weight of 322.34 g/mol. Its IUPAC name is 1,3-bis(oxiran-2-ylmethyl)-1,5-bis(prop-2-enyl)-1,3,5-triazinan-1-ium-2,4,6-trione.
| Compound Name | 1,3-bis(oxiran-2-ylmethyl)-1,5-bis(prop-2-enyl)-1,3,5-triazinan-1-ium-2,4,6-trione |
|---|---|
| PubChem CID | 87342161 |
| Molecular Formula | C15H20N3O5+ |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1,3-bis(oxiran-2-ylmethyl)-1,5-bis(prop-2-enyl)-1,3,5-triazinan-1-ium-2,4,6-trione |
| SMILES | C=CCN1C(=O)N(CC2CO2)C(=O)[N+](CC=C)(CC2CO2)C1=O |
| InChI | InChI=1S/C15H20N3O5/c1-3-5-16-13(19)17(7-11-9-22-11)15(21)18(6-4-2,14(16)20)8-12-10-23-12/h3-4,11-12H,1-2,5-10H2/q+1 |
| InChIKey | VYQRZXWECIOACI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 82.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|