C8H9NO3 — CID 130493104
3-[[(2R)-oxiran-2-yl]methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 130493104) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 3-[[(2R)-oxiran-2-yl]methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-[[(2R)-oxiran-2-yl]methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 130493104 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 3-[[(2R)-oxiran-2-yl]methyl]-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | O=C1C2CC2C(=O)N1C[C@@H]1CO1 |
| InChI | InChI=1S/C8H9NO3/c10-7-5-1-6(5)8(11)9(7)2-4-3-12-4/h4-6H,1-3H2/t4-,5?,6?/m1/s1 |
| InChIKey | ANIUJQCUNIJKMO-IISSFJTQSA-N |
| XLogP | -0.61 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|