C27H36N6O6 — CID 174226732
6-methylidene-1,3-bis(2-methylprop-2-enyl)-5-(2-oxopropyl)-1,3,5-triazinane-2,4-dione;1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 174226732) has the molecular formula C27H36N6O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is 6-methylidene-1,3-bis(2-methylprop-2-enyl)-5-(2-oxopropyl)-1,3,5-triazinane-2,4-dione;1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 6-methylidene-1,3-bis(2-methylprop-2-enyl)-5-(2-oxopropyl)-1,3,5-triazinane-2,4-dione;1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 174226732 |
| Molecular Formula | C27H36N6O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 6-methylidene-1,3-bis(2-methylprop-2-enyl)-5-(2-oxopropyl)-1,3,5-triazinane-2,4-dione;1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=C(C)CN1C(=C)N(CC(C)=O)C(=O)N(CC(=C)C)C1=O.C=CCn1c(=O)n(CC=C)c(=O)n(CC=C)c1=O |
| InChI | InChI=1S/C15H21N3O3.C12H15N3O3/c1-10(2)7-16-13(6)17(9-12(5)19)15(21)18(14(16)20)8-11(3)4;1-4-7-13-10(16)14(8-5-2)12(18)15(9-6-3)11(13)17/h1,3,6-9H2,2,4-5H3;4-6H,1-3,7-9H2 |
| InChIKey | FZLCOYPCRMOCFJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 126.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|