C8H15N3O — CID 101375506
1,3-dimethyl-5-prop-2-enyl-1,3,5-triazinan-2-one (PubChem CID 101375506) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 1,3-dimethyl-5-prop-2-enyl-1,3,5-triazinan-2-one.
| Compound Name | 1,3-dimethyl-5-prop-2-enyl-1,3,5-triazinan-2-one |
|---|---|
| PubChem CID | 101375506 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 1,3-dimethyl-5-prop-2-enyl-1,3,5-triazinan-2-one |
| SMILES | C=CCN1CN(C)C(=O)N(C)C1 |
| InChI | InChI=1S/C8H15N3O/c1-4-5-11-6-9(2)8(12)10(3)7-11/h4H,1,5-7H2,2-3H3 |
| InChIKey | CKXIMUVYXJGCCE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|