C10H18N2O — CID 135080777
1-methyl-4-(2-methylpropyl)-3-prop-2-enyl-1,3-diazetidin-2-one (PubChem CID 135080777) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-methyl-4-(2-methylpropyl)-3-prop-2-enyl-1,3-diazetidin-2-one.
| Compound Name | 1-methyl-4-(2-methylpropyl)-3-prop-2-enyl-1,3-diazetidin-2-one |
|---|---|
| PubChem CID | 135080777 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 1-methyl-4-(2-methylpropyl)-3-prop-2-enyl-1,3-diazetidin-2-one |
| SMILES | C=CCN1C(=O)N(C)C1CC(C)C |
| InChI | InChI=1S/C10H18N2O/c1-5-6-12-9(7-8(2)3)11(4)10(12)13/h5,8-9H,1,6-7H2,2-4H3 |
| InChIKey | PZHGOUAYECMCPK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|