C10H14N4O2 — CID 125479840
(3aS,6aS)-4,6-bis(prop-2-enyl)-1,3,3a,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione (PubChem CID 125479840) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is (3aS,6aS)-4,6-bis(prop-2-enyl)-1,3,3a,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | (3aS,6aS)-4,6-bis(prop-2-enyl)-1,3,3a,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 125479840 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (3aS,6aS)-4,6-bis(prop-2-enyl)-1,3,3a,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dione |
| SMILES | C=CCN1C(=O)N(CC=C)[C@@H]2NC(=O)N[C@H]21 |
| InChI | InChI=1S/C10H14N4O2/c1-3-5-13-7-8(12-9(15)11-7)14(6-4-2)10(13)16/h3-4,7-8H,1-2,5-6H2,(H2,11,12,15)/t7-,8-/m0/s1 |
| InChIKey | QYDOSIUACUHJHT-YUMQZZPRSA-N |
| XLogP | 0.06 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|