C10H17NO2 — CID 89318251
(3S)-3-ethyl-1-hydroxy-3-prop-2-enylpiperidin-2-one (PubChem CID 89318251) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (3S)-3-ethyl-1-hydroxy-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3S)-3-ethyl-1-hydroxy-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 89318251 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (3S)-3-ethyl-1-hydroxy-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@]1(CC)CCCN(O)C1=O |
| InChI | InChI=1S/C10H17NO2/c1-3-6-10(4-2)7-5-8-11(13)9(10)12/h3,13H,1,4-8H2,2H3/t10-/m1/s1 |
| InChIKey | SMICRJNMUALGCW-SNVBAGLBSA-N |
| XLogP | 1.97 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|