C22H34N2O6 — CID 138751743
[(5R)-5-ethyl-1-hydroxy-6-oxo-5-prop-2-enylpiperidin-3-yl]methyl 3-[(3R)-1-hydroxy-2-oxo-3-prop-2-enylpiperidin-3-yl]propanoate (PubChem CID 138751743) has the molecular formula C22H34N2O6 and a molecular weight of 422.52 g/mol. Its IUPAC name is [(5R)-5-ethyl-1-hydroxy-6-oxo-5-prop-2-enylpiperidin-3-yl]methyl 3-[(3R)-1-hydroxy-2-oxo-3-prop-2-enylpiperidin-3-yl]propanoate.
| Compound Name | [(5R)-5-ethyl-1-hydroxy-6-oxo-5-prop-2-enylpiperidin-3-yl]methyl 3-[(3R)-1-hydroxy-2-oxo-3-prop-2-enylpiperidin-3-yl]propanoate |
|---|---|
| PubChem CID | 138751743 |
| Molecular Formula | C22H34N2O6 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | [(5R)-5-ethyl-1-hydroxy-6-oxo-5-prop-2-enylpiperidin-3-yl]methyl 3-[(3R)-1-hydroxy-2-oxo-3-prop-2-enylpiperidin-3-yl]propanoate |
| SMILES | C=CC[C@]1(CCC(=O)OCC2CN(O)C(=O)[C@](CC)(CC=C)C2)CCCN(O)C1=O |
| InChI | InChI=1S/C22H34N2O6/c1-4-9-21(6-3)14-17(15-24(29)19(21)26)16-30-18(25)8-12-22(10-5-2)11-7-13-23(28)20(22)27/h4-5,17,28-29H,1-2,6-16H2,3H3/t17?,21-,22-/m1/s1 |
| InChIKey | XMYAGSLPROXMIW-TWBYEDGTSA-N |
| XLogP | 3.09 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|