C8H13NOS — CID 115646869
3-(3-methylbutyl)-1,3-thiazol-2-one (PubChem CID 115646869) has the molecular formula C8H13NOS and a molecular weight of 171.27 g/mol. Its IUPAC name is 3-(3-methylbutyl)-1,3-thiazol-2-one.
| Compound Name | 3-(3-methylbutyl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 115646869 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 3-(3-methylbutyl)-1,3-thiazol-2-one |
| SMILES | CC(C)CCn1ccsc1=O |
| InChI | InChI=1S/C8H13NOS/c1-7(2)3-4-9-5-6-11-8(9)10/h5-7H,3-4H2,1-2H3 |
| InChIKey | HLNIRCDWDUFFGK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |