About ethane;2-methylpropane;3-propan-2-yl-1,3-thiazol-2-one
ethane;2-methylpropane;3-propan-2-yl-1,3-thiazol-2-one (PubChem CID 159650406) has the molecular formula C12H25NOS
and a molecular weight of 231.40 g/mol. Its IUPAC name is ethane;2-methylpropane;3-propan-2-yl-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | ethane;2-methylpropane;3-propan-2-yl-1,3-thiazol-2-one |
| PubChem CID | 159650406 |
| Molecular Formula | C12H25NOS |
| Molecular Weight | 231.40 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | ethane;2-methylpropane;3-propan-2-yl-1,3-thiazol-2-one |
| SMILES | CC.CC(C)C.CC(C)n1ccsc1=O |
| InChI | InChI=1S/C6H9NOS.C4H10.C2H6/c1-5(2)7-3-4-9-6(7)8;1-4(2)3;1-2/h3-5H,1-2H3;4H,1-3H3;1-2H3 |
| InChIKey | MRMLCBDJDHMLGR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methylpropane;3-propan-2-yl-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropane;3-propan-2-yl-1,3-thiazol-2-one?
The IUPAC name of ethane;2-methylpropane;3-propan-2-yl-1,3-thiazol-2-one (CID 159650406) is ethane;2-methylpropane;3-propan-2-yl-1,3-thiazol-2-one.
What is the SMILES notation for ethane;2-methylpropane;3-propan-2-yl-1,3-thiazol-2-one?
The canonical SMILES for ethane;2-methylpropane;3-propan-2-yl-1,3-thiazol-2-one is CC.CC(C)C.CC(C)n1ccsc1=O.
What is the InChIKey of ethane;2-methylpropane;3-propan-2-yl-1,3-thiazol-2-one?
The InChIKey is MRMLCBDJDHMLGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NOS.C4H10.C2H6/c1-5(2)7-3-4-9-6(7)8;1-4(2)3;1-2/h3-5H,1-2H3;4H,1-3H3;1-2H3.
What are the key properties of ethane;2-methylpropane;3-propan-2-yl-1,3-thiazol-2-one?
ethane;2-methylpropane;3-propan-2-yl-1,3-thiazol-2-one has a molecular weight of 231.40 g/mol, XLogP of 4.18, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropane;3-propan-2-yl-1,3-thiazol-2-one is sourced from PubChem (CID 159650406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).