About S-ethenyl N-ethenyl-N-propan-2-ylcarbamothioate
S-ethenyl N-ethenyl-N-propan-2-ylcarbamothioate (PubChem CID 167191445) has the molecular formula C8H13NOS
and a molecular weight of 171.26 g/mol. Its IUPAC name is S-ethenyl N-ethenyl-N-propan-2-ylcarbamothioate.
Molecular Properties
| Compound Name | S-ethenyl N-ethenyl-N-propan-2-ylcarbamothioate |
| PubChem CID | 167191445 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | S-ethenyl N-ethenyl-N-propan-2-ylcarbamothioate |
| SMILES | C=CSC(=O)N(C=C)C(C)C |
| InChI | InChI=1S/C8H13NOS/c1-5-9(7(3)4)8(10)11-6-2/h5-7H,1-2H2,3-4H3 |
| InChIKey | CNGJUJPWOBSVIB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethenyl N-ethenyl-N-propan-2-ylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethenyl N-ethenyl-N-propan-2-ylcarbamothioate?
The IUPAC name of S-ethenyl N-ethenyl-N-propan-2-ylcarbamothioate (CID 167191445) is S-ethenyl N-ethenyl-N-propan-2-ylcarbamothioate.
What is the SMILES notation for S-ethenyl N-ethenyl-N-propan-2-ylcarbamothioate?
The canonical SMILES for S-ethenyl N-ethenyl-N-propan-2-ylcarbamothioate is C=CSC(=O)N(C=C)C(C)C.
What is the InChIKey of S-ethenyl N-ethenyl-N-propan-2-ylcarbamothioate?
The InChIKey is CNGJUJPWOBSVIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NOS/c1-5-9(7(3)4)8(10)11-6-2/h5-7H,1-2H2,3-4H3.
What are the key properties of S-ethenyl N-ethenyl-N-propan-2-ylcarbamothioate?
S-ethenyl N-ethenyl-N-propan-2-ylcarbamothioate has a molecular weight of 171.26 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethenyl N-ethenyl-N-propan-2-ylcarbamothioate is sourced from PubChem (CID 167191445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).