C7H11NOS — CID 115659278
3-(2-methylpropyl)-1,3-thiazol-2-one (PubChem CID 115659278) has the molecular formula C7H11NOS and a molecular weight of 157.24 g/mol. Its IUPAC name is 3-(2-methylpropyl)-1,3-thiazol-2-one.
| Compound Name | 3-(2-methylpropyl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 115659278 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 3-(2-methylpropyl)-1,3-thiazol-2-one |
| SMILES | CC(C)Cn1ccsc1=O |
| InChI | InChI=1S/C7H11NOS/c1-6(2)5-8-3-4-10-7(8)9/h3-4,6H,5H2,1-2H3 |
| InChIKey | ASNBJNMVULBLBE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |