C9H9ClF2N2O — CID 11564909
N-(2-amino-4,5-difluorophenyl)-2-chloropropanamide (PubChem CID 11564909) has the molecular formula C9H9ClF2N2O and a molecular weight of 234.63 g/mol. Its IUPAC name is N-(2-amino-4,5-difluorophenyl)-2-chloropropanamide.
| Compound Name | N-(2-amino-4,5-difluorophenyl)-2-chloropropanamide |
|---|---|
| PubChem CID | 11564909 |
| Molecular Formula | C9H9ClF2N2O |
| Molecular Weight | 234.63 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | N-(2-amino-4,5-difluorophenyl)-2-chloropropanamide |
| SMILES | CC(Cl)C(=O)Nc1cc(F)c(F)cc1N |
| InChI | InChI=1S/C9H9ClF2N2O/c1-4(10)9(15)14-8-3-6(12)5(11)2-7(8)13/h2-4H,13H2,1H3,(H,14,15) |
| InChIKey | NDPHJXKSAHCMMS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.63 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|