C7H14N4S2 — CID 115650969
4-methyl-5-(3-methylsulfanylpropylsulfanyl)-1,2,4-triazol-3-amine (PubChem CID 115650969) has the molecular formula C7H14N4S2 and a molecular weight of 218.35 g/mol. Its IUPAC name is 4-methyl-5-(3-methylsulfanylpropylsulfanyl)-1,2,4-triazol-3-amine.
| Compound Name | 4-methyl-5-(3-methylsulfanylpropylsulfanyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 115650969 |
| Molecular Formula | C7H14N4S2 |
| Molecular Weight | 218.35 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 4-methyl-5-(3-methylsulfanylpropylsulfanyl)-1,2,4-triazol-3-amine |
| SMILES | CSCCCSc1nnc(N)n1C |
| InChI | InChI=1S/C7H14N4S2/c1-11-6(8)9-10-7(11)13-5-3-4-12-2/h3-5H2,1-2H3,(H2,8,9) |
| InChIKey | KMCJMGHXBBKSLD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|