C12H17N3 — CID 115651142
N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]propan-1-amine (PubChem CID 115651142) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115651142 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methyl]propan-1-amine |
| SMILES | CCCNCc1cnc2c(C)cccn12 |
| InChI | InChI=1S/C12H17N3/c1-3-6-13-8-11-9-14-12-10(2)5-4-7-15(11)12/h4-5,7,9,13H,3,6,8H2,1-2H3 |
| InChIKey | IEAAKBAWKPSCIE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|