C10H13N5S — CID 115656745
N-[(1-cyclopropyltetrazol-5-yl)methyl]-1-thiophen-3-ylmethanamine (PubChem CID 115656745) has the molecular formula C10H13N5S and a molecular weight of 235.32 g/mol. Its IUPAC name is N-[(1-cyclopropyltetrazol-5-yl)methyl]-1-thiophen-3-ylmethanamine.
| Compound Name | N-[(1-cyclopropyltetrazol-5-yl)methyl]-1-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 115656745 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | N-[(1-cyclopropyltetrazol-5-yl)methyl]-1-thiophen-3-ylmethanamine |
| SMILES | c1cc(CNCc2nnnn2C2CC2)cs1 |
| InChI | InChI=1S/C10H13N5S/c1-2-9(1)15-10(12-13-14-15)6-11-5-8-3-4-16-7-8/h3-4,7,9,11H,1-2,5-6H2 |
| InChIKey | FFLKMKQPNRQUJJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |