C7H11NOS2 — CID 115659258
3-(2-ethylsulfanylethyl)-1,3-thiazol-2-one (PubChem CID 115659258) has the molecular formula C7H11NOS2 and a molecular weight of 189.31 g/mol. Its IUPAC name is 3-(2-ethylsulfanylethyl)-1,3-thiazol-2-one.
| Compound Name | 3-(2-ethylsulfanylethyl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 115659258 |
| Molecular Formula | C7H11NOS2 |
| Molecular Weight | 189.31 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | 3-(2-ethylsulfanylethyl)-1,3-thiazol-2-one |
| SMILES | CCSCCn1ccsc1=O |
| InChI | InChI=1S/C7H11NOS2/c1-2-10-5-3-8-4-6-11-7(8)9/h4,6H,2-3,5H2,1H3 |
| InChIKey | HGTSWJXNOMVELX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|