C14H20N4S — CID 115660602
1-ethylsulfanyl-N-[(2-phenyltriazol-4-yl)methyl]propan-2-amine (PubChem CID 115660602) has the molecular formula C14H20N4S and a molecular weight of 276.41 g/mol. Its IUPAC name is 1-ethylsulfanyl-N-[(2-phenyltriazol-4-yl)methyl]propan-2-amine.
| Compound Name | 1-ethylsulfanyl-N-[(2-phenyltriazol-4-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 115660602 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-ethylsulfanyl-N-[(2-phenyltriazol-4-yl)methyl]propan-2-amine |
| SMILES | CCSCC(C)NCc1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H20N4S/c1-3-19-11-12(2)15-9-13-10-16-18(17-13)14-7-5-4-6-8-14/h4-8,10,12,15H,3,9,11H2,1-2H3 |
| InChIKey | WZNVKRPFABUPEX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |