C12H18FNS — CID 115660784
1-ethylsulfanyl-N-[(2-fluorophenyl)methyl]propan-2-amine (PubChem CID 115660784) has the molecular formula C12H18FNS and a molecular weight of 227.35 g/mol. Its IUPAC name is 1-ethylsulfanyl-N-[(2-fluorophenyl)methyl]propan-2-amine.
| Compound Name | 1-ethylsulfanyl-N-[(2-fluorophenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 115660784 |
| Molecular Formula | C12H18FNS |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-ethylsulfanyl-N-[(2-fluorophenyl)methyl]propan-2-amine |
| SMILES | CCSCC(C)NCc1ccccc1F |
| InChI | InChI=1S/C12H18FNS/c1-3-15-9-10(2)14-8-11-6-4-5-7-12(11)13/h4-7,10,14H,3,8-9H2,1-2H3 |
| InChIKey | HEWVXBCGKILWQY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |