C13H17F4NS — CID 115907759
1-ethylsulfanyl-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]propan-2-amine (PubChem CID 115907759) has the molecular formula C13H17F4NS and a molecular weight of 295.35 g/mol. Its IUPAC name is 1-ethylsulfanyl-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]propan-2-amine.
| Compound Name | 1-ethylsulfanyl-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 115907759 |
| Molecular Formula | C13H17F4NS |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-ethylsulfanyl-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]propan-2-amine |
| SMILES | CCSCC(C)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C13H17F4NS/c1-3-19-8-9(2)18-7-10-4-5-11(14)6-12(10)13(15,16)17/h4-6,9,18H,3,7-8H2,1-2H3 |
| InChIKey | VBLHEKGSJWUWHZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |