C8H12F3NOS — CID 115661631
1-(2-ethylthiomorpholin-4-yl)-2,2,2-trifluoroethanone (PubChem CID 115661631) has the molecular formula C8H12F3NOS and a molecular weight of 227.25 g/mol. Its IUPAC name is 1-(2-ethylthiomorpholin-4-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(2-ethylthiomorpholin-4-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 115661631 |
| Molecular Formula | C8H12F3NOS |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 1-(2-ethylthiomorpholin-4-yl)-2,2,2-trifluoroethanone |
| SMILES | CCC1CN(C(=O)C(F)(F)F)CCS1 |
| InChI | InChI=1S/C8H12F3NOS/c1-2-6-5-12(3-4-14-6)7(13)8(9,10)11/h6H,2-5H2,1H3 |
| InChIKey | GARNIFDEIOOJCS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |