C11H22N2S2 — CID 115662362
N-butyl-2,6-dimethylthiomorpholine-4-carbothioamide (PubChem CID 115662362) has the molecular formula C11H22N2S2 and a molecular weight of 246.44 g/mol. Its IUPAC name is N-butyl-2,6-dimethylthiomorpholine-4-carbothioamide.
| Compound Name | N-butyl-2,6-dimethylthiomorpholine-4-carbothioamide |
|---|---|
| PubChem CID | 115662362 |
| Molecular Formula | C11H22N2S2 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-butyl-2,6-dimethylthiomorpholine-4-carbothioamide |
| SMILES | CCCCNC(=S)N1CC(C)SC(C)C1 |
| InChI | InChI=1S/C11H22N2S2/c1-4-5-6-12-11(14)13-7-9(2)15-10(3)8-13/h9-10H,4-8H2,1-3H3,(H,12,14) |
| InChIKey | MAHCIRUMGFZIGC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|