C10H19N3O — CID 115665641
2-methyl-3-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]propan-1-ol (PubChem CID 115665641) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]propan-1-ol.
| Compound Name | 2-methyl-3-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 115665641 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2-methyl-3-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]propan-1-ol |
| SMILES | CC(CO)CN(C)Cc1cnn(C)c1 |
| InChI | InChI=1S/C10H19N3O/c1-9(8-14)5-12(2)6-10-4-11-13(3)7-10/h4,7,9,14H,5-6,8H2,1-3H3 |
| InChIKey | XFOZKMMZPGEEBV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |