C17H31N3O3S — CID 11566615
(2S)-2-(4,4-dimethoxybutan-2-ylamino)-N-(5-propan-2-yl-1,3-thiazol-2-yl)pentanamide (PubChem CID 11566615) has the molecular formula C17H31N3O3S and a molecular weight of 357.52 g/mol. Its IUPAC name is (2S)-2-(4,4-dimethoxybutan-2-ylamino)-N-(5-propan-2-yl-1,3-thiazol-2-yl)pentanamide.
| Compound Name | (2S)-2-(4,4-dimethoxybutan-2-ylamino)-N-(5-propan-2-yl-1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 11566615 |
| Molecular Formula | C17H31N3O3S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (2S)-2-(4,4-dimethoxybutan-2-ylamino)-N-(5-propan-2-yl-1,3-thiazol-2-yl)pentanamide |
| SMILES | CCC[C@H](NC(C)CC(OC)OC)C(=O)Nc1ncc(C(C)C)s1 |
| InChI | InChI=1S/C17H31N3O3S/c1-7-8-13(19-12(4)9-15(22-5)23-6)16(21)20-17-18-10-14(24-17)11(2)3/h10-13,15,19H,7-9H2,1-6H3,(H,18,20,21)/t12?,13-/m0/s1 |
| InChIKey | IOCFKSRZEIOKGJ-ABLWVSNPSA-N |
| XLogP | 3.36 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|