C14H16N2O4 — CID 115670093
methyl 4-[(E)-3-pyridin-3-ylprop-2-enoyl]morpholine-3-carboxylate (PubChem CID 115670093) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl 4-[(E)-3-pyridin-3-ylprop-2-enoyl]morpholine-3-carboxylate.
| Compound Name | methyl 4-[(E)-3-pyridin-3-ylprop-2-enoyl]morpholine-3-carboxylate |
|---|---|
| PubChem CID | 115670093 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | methyl 4-[(E)-3-pyridin-3-ylprop-2-enoyl]morpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1C(=O)/C=C/c1cccnc1 |
| InChI | InChI=1S/C14H16N2O4/c1-19-14(18)12-10-20-8-7-16(12)13(17)5-4-11-3-2-6-15-9-11/h2-6,9,12H,7-8,10H2,1H3/b5-4+ |
| InChIKey | DATZRQBFFSJZTM-SNAWJCMRSA-N |
| XLogP | 0.50 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|