About 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol
2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol (PubChem CID 11567022) has the molecular formula C23H27N3O2
and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol.
Molecular Properties
| Compound Name | 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol |
| PubChem CID | 11567022 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol |
| SMILES | COCCCN(C)C(c1ccccc1)C(O)(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C23H27N3O2/c1-26(15-8-16-28-2)22(19-9-4-3-5-10-19)23(27,20-11-6-13-24-17-20)21-12-7-14-25-18-21/h3-7,9-14,17-18,22,27H,8,15-16H2,1-2H3 |
| InChIKey | FWEPGNKEKKOWQR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol?
The IUPAC name of 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol (CID 11567022) is 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol.
What is the SMILES notation for 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol?
The canonical SMILES for 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol is COCCCN(C)C(c1ccccc1)C(O)(c1cccnc1)c1cccnc1.
What is the InChIKey of 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol?
The InChIKey is FWEPGNKEKKOWQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O2/c1-26(15-8-16-28-2)22(19-9-4-3-5-10-19)23(27,20-11-6-13-24-17-20)21-12-7-14-25-18-21/h3-7,9-14,17-18,22,27H,8,15-16H2,1-2H3.
What are the key properties of 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol?
2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol has a molecular weight of 377.49 g/mol, XLogP of 3.42, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol is sourced from PubChem (CID 11567022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).