C23H27N3O2 — CID 11567022
2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol (PubChem CID 11567022) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol.
| Compound Name | 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol |
|---|---|
| PubChem CID | 11567022 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-[3-methoxypropyl(methyl)amino]-2-phenyl-1,1-dipyridin-3-ylethanol |
| SMILES | COCCCN(C)C(c1ccccc1)C(O)(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C23H27N3O2/c1-26(15-8-16-28-2)22(19-9-4-3-5-10-19)23(27,20-11-6-13-24-17-20)21-12-7-14-25-18-21/h3-7,9-14,17-18,22,27H,8,15-16H2,1-2H3 |
| InChIKey | FWEPGNKEKKOWQR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|