C13H16BrNO5S — CID 115672139
methyl 4-(5-bromo-2-methylphenyl)sulfonylmorpholine-3-carboxylate (PubChem CID 115672139) has the molecular formula C13H16BrNO5S and a molecular weight of 378.24 g/mol. Its IUPAC name is methyl 4-(5-bromo-2-methylphenyl)sulfonylmorpholine-3-carboxylate.
| Compound Name | methyl 4-(5-bromo-2-methylphenyl)sulfonylmorpholine-3-carboxylate |
|---|---|
| PubChem CID | 115672139 |
| Molecular Formula | C13H16BrNO5S |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | methyl 4-(5-bromo-2-methylphenyl)sulfonylmorpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1S(=O)(=O)c1cc(Br)ccc1C |
| InChI | InChI=1S/C13H16BrNO5S/c1-9-3-4-10(14)7-12(9)21(17,18)15-5-6-20-8-11(15)13(16)19-2/h3-4,7,11H,5-6,8H2,1-2H3 |
| InChIKey | SKUNPSRZAIZOEO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |