C9H12N4 — CID 115674360
N-(imidazo[1,2-a]pyrazin-3-ylmethyl)ethanamine (PubChem CID 115674360) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is N-(imidazo[1,2-a]pyrazin-3-ylmethyl)ethanamine.
| Compound Name | N-(imidazo[1,2-a]pyrazin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115674360 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | N-(imidazo[1,2-a]pyrazin-3-ylmethyl)ethanamine |
| SMILES | CCNCc1cnc2cnccn12 |
| InChI | InChI=1S/C9H12N4/c1-2-10-5-8-6-12-9-7-11-3-4-13(8)9/h3-4,6-7,10H,2,5H2,1H3 |
| InChIKey | KUROYPHISVGXEW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |