C9H19N3 — CID 115679577
1-[(E)-pent-3-enyl]-2-propylguanidine (PubChem CID 115679577) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is 1-[(E)-pent-3-enyl]-2-propylguanidine.
| Compound Name | 1-[(E)-pent-3-enyl]-2-propylguanidine |
|---|---|
| PubChem CID | 115679577 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | 1-[(E)-pent-3-enyl]-2-propylguanidine |
| SMILES | C/C=C/CCN/C(N)=N/CCC |
| InChI | InChI=1S/C9H19N3/c1-3-5-6-8-12-9(10)11-7-4-2/h3,5H,4,6-8H2,1-2H3,(H3,10,11,12)/b5-3+ |
| InChIKey | XLJMKXSQDRXVBT-HWKANZROSA-N |
| XLogP | 1.27 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|