C10H19F3IN3 — CID 111986500
2-methyl-1-[(E)-pent-3-enyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111986500) has the molecular formula C10H19F3IN3 and a molecular weight of 365.18 g/mol. Its IUPAC name is 2-methyl-1-[(E)-pent-3-enyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(E)-pent-3-enyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111986500 |
| Molecular Formula | C10H19F3IN3 |
| Molecular Weight | 365.18 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-methyl-1-[(E)-pent-3-enyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/C=C/CCN/C(=N\C)NCCC(F)(F)F.I |
| InChI | InChI=1S/C10H18F3N3.HI/c1-3-4-5-7-15-9(14-2)16-8-6-10(11,12)13;/h3-4H,5-8H2,1-2H3,(H2,14,15,16);1H/b4-3+; |
| InChIKey | NFXJQZRPOWYOQR-BJILWQEISA-N |
| XLogP | 2.69 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|