C10H19F2N3 — CID 109497790
3-(2,2-difluoroethyl)-1,2-dimethyl-1-pent-4-enylguanidine (PubChem CID 109497790) has the molecular formula C10H19F2N3 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-1,2-dimethyl-1-pent-4-enylguanidine.
| Compound Name | 3-(2,2-difluoroethyl)-1,2-dimethyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109497790 |
| Molecular Formula | C10H19F2N3 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 3-(2,2-difluoroethyl)-1,2-dimethyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N/C)NCC(F)F |
| InChI | InChI=1S/C10H19F2N3/c1-4-5-6-7-15(3)10(13-2)14-8-9(11)12/h4,9H,1,5-8H2,2-3H3,(H,13,14) |
| InChIKey | YXCYQEFMVQPYBP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|