C11H21F2N3 — CID 109497288
2-(2,2-difluoroethyl)-3-ethyl-1-methyl-1-pent-4-enylguanidine (PubChem CID 109497288) has the molecular formula C11H21F2N3 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-3-ethyl-1-methyl-1-pent-4-enylguanidine.
| Compound Name | 2-(2,2-difluoroethyl)-3-ethyl-1-methyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109497288 |
| Molecular Formula | C11H21F2N3 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.17 |
| IUPAC Name | 2-(2,2-difluoroethyl)-3-ethyl-1-methyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N\CC(F)F)NCC |
| InChI | InChI=1S/C11H21F2N3/c1-4-6-7-8-16(3)11(14-5-2)15-9-10(12)13/h4,10H,1,5-9H2,2-3H3,(H,14,15) |
| InChIKey | YRUPALDYBWSFFG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|