C11H20F3N3 — CID 109497268
1,2-dimethyl-1-pent-4-enyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109497268) has the molecular formula C11H20F3N3 and a molecular weight of 251.30 g/mol. Its IUPAC name is 1,2-dimethyl-1-pent-4-enyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1,2-dimethyl-1-pent-4-enyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109497268 |
| Molecular Formula | C11H20F3N3 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 1,2-dimethyl-1-pent-4-enyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C=CCCCN(C)/C(=N/C)NCCC(F)(F)F |
| InChI | InChI=1S/C11H20F3N3/c1-4-5-6-9-17(3)10(15-2)16-8-7-11(12,13)14/h4H,1,5-9H2,2-3H3,(H,15,16) |
| InChIKey | XBMXKHAQJBLGAG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|