C11H20ClN3 — CID 115680433
N-[(1-methylcyclobutyl)methyl]-1-(1-methylpyrazol-3-yl)methanamine;hydrochloride (PubChem CID 115680433) has the molecular formula C11H20ClN3 and a molecular weight of 229.75 g/mol. Its IUPAC name is N-[(1-methylcyclobutyl)methyl]-1-(1-methylpyrazol-3-yl)methanamine;hydrochloride.
| Compound Name | N-[(1-methylcyclobutyl)methyl]-1-(1-methylpyrazol-3-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 115680433 |
| Molecular Formula | C11H20ClN3 |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-[(1-methylcyclobutyl)methyl]-1-(1-methylpyrazol-3-yl)methanamine;hydrochloride |
| SMILES | Cl.Cn1ccc(CNCC2(C)CCC2)n1 |
| InChI | InChI=1S/C11H19N3.ClH/c1-11(5-3-6-11)9-12-8-10-4-7-14(2)13-10;/h4,7,12H,3,5-6,8-9H2,1-2H3;1H |
| InChIKey | IHDSENWSXCLNOQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |